C15H16FN3O3 — CID 136587463
[(4aS,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl]-(4-fluoro-1H-benzimidazol-5-yl)methanone (PubChem CID 136587463) has the molecular formula C15H16FN3O3 and a molecular weight of 305.31 g/mol. Its IUPAC name is [(4aS,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl]-(4-fluoro-1H-benzimidazol-5-yl)methanone.
| Compound Name | [(4aS,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl]-(4-fluoro-1H-benzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 136587463 |
| Molecular Formula | C15H16FN3O3 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | [(4aS,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl]-(4-fluoro-1H-benzimidazol-5-yl)methanone |
| SMILES | O=C(c1ccc2[nH]cnc2c1F)N1CCO[C@@H]2COCC[C@@H]21 |
| InChI | InChI=1S/C15H16FN3O3/c16-13-9(1-2-10-14(13)18-8-17-10)15(20)19-4-6-22-12-7-21-5-3-11(12)19/h1-2,8,11-12H,3-7H2,(H,17,18)/t11-,12+/m0/s1 |
| InChIKey | AVQOEGUZPLEQPB-NWDGAFQWSA-N |
| XLogP | 1.33 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |