C9H10N2O — CID 136594475
(2E,3E)-3-ethylidene-2-(2-iminoethylidene)-1H-pyridin-4-one (PubChem CID 136594475) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is (2E,3E)-3-ethylidene-2-(2-iminoethylidene)-1H-pyridin-4-one.
| Compound Name | (2E,3E)-3-ethylidene-2-(2-iminoethylidene)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 136594475 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | (2E,3E)-3-ethylidene-2-(2-iminoethylidene)-1H-pyridin-4-one |
| SMILES | [H]/N=C/C=c1/[nH]ccc(=O)/c1=C/C |
| InChI | InChI=1S/C9H10N2O/c1-2-7-8(3-5-10)11-6-4-9(7)12/h2-6,10-11H,1H3/b7-2+,8-3+,10-5+ |
| InChIKey | FKLOQAFLUUPZBS-ZJMNIPNBSA-N |
| XLogP | -0.39 |
| TPSA | 56.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|