C18H24IN5O2 — CID 136595789
4-(cycloheptylamino)-6-[3-(iodomethyl)-4-methoxyanilino]-1H-1,3,5-triazin-2-one (PubChem CID 136595789) has the molecular formula C18H24IN5O2 and a molecular weight of 469.33 g/mol. Its IUPAC name is 4-(cycloheptylamino)-6-[3-(iodomethyl)-4-methoxyanilino]-1H-1,3,5-triazin-2-one.
| Compound Name | 4-(cycloheptylamino)-6-[3-(iodomethyl)-4-methoxyanilino]-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 136595789 |
| Molecular Formula | C18H24IN5O2 |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 4-(cycloheptylamino)-6-[3-(iodomethyl)-4-methoxyanilino]-1H-1,3,5-triazin-2-one |
| SMILES | COc1ccc(Nc2nc(NC3CCCCCC3)nc(=O)[nH]2)cc1CI |
| InChI | InChI=1S/C18H24IN5O2/c1-26-15-9-8-14(10-12(15)11-19)21-17-22-16(23-18(25)24-17)20-13-6-4-2-3-5-7-13/h8-10,13H,2-7,11H2,1H3,(H3,20,21,22,23,24,25) |
| InChIKey | NRWRQFTTWTTWFK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|