C25H37IN6O2 — CID 89388799
2-N-cycloheptyl-6-[(1-ethylpyrrolidin-2-yl)methoxy]-4-N-[3-(iodomethyl)-4-methoxyphenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 89388799) has the molecular formula C25H37IN6O2 and a molecular weight of 580.52 g/mol. Its IUPAC name is 2-N-cycloheptyl-6-[(1-ethylpyrrolidin-2-yl)methoxy]-4-N-[3-(iodomethyl)-4-methoxyphenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-cycloheptyl-6-[(1-ethylpyrrolidin-2-yl)methoxy]-4-N-[3-(iodomethyl)-4-methoxyphenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 89388799 |
| Molecular Formula | C25H37IN6O2 |
| Molecular Weight | 580.52 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 2-N-cycloheptyl-6-[(1-ethylpyrrolidin-2-yl)methoxy]-4-N-[3-(iodomethyl)-4-methoxyphenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCN1CCCC1COc1nc(Nc2ccc(OC)c(CI)c2)nc(NC2CCCCCC2)n1 |
| InChI | InChI=1S/C25H37IN6O2/c1-3-32-14-8-11-21(32)17-34-25-30-23(27-19-9-6-4-5-7-10-19)29-24(31-25)28-20-12-13-22(33-2)18(15-20)16-26/h12-13,15,19,21H,3-11,14,16-17H2,1-2H3,(H2,27,28,29,30,31) |
| InChIKey | PTIPNLLUQYDKBD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|