C54H87Cl3N16 — CID 169427399
bis(4-N-[3-chloro-4-(diethylamino)phenyl]-2-N-cycloheptyl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine);hydrochloride (PubChem CID 169427399) has the molecular formula C54H87Cl3N16 and a molecular weight of 1066.76 g/mol. Its IUPAC name is bis(4-N-[3-chloro-4-(diethylamino)phenyl]-2-N-cycloheptyl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine);hydrochloride.
| Compound Name | bis(4-N-[3-chloro-4-(diethylamino)phenyl]-2-N-cycloheptyl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine);hydrochloride |
|---|---|
| PubChem CID | 169427399 |
| Molecular Formula | C54H87Cl3N16 |
| Molecular Weight | 1066.76 g/mol |
| Exact Mass | 1064.64 |
| IUPAC Name | bis(4-N-[3-chloro-4-(diethylamino)phenyl]-2-N-cycloheptyl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine);hydrochloride |
| SMILES | CCN(CC)c1ccc(Nc2nc(NCC3CCCN3CC)nc(NC3CCCCCC3)n2)cc1Cl.CCN(CC)c1ccc(Nc2nc(NCC3CCCN3CC)nc(NC3CCCCCC3)n2)cc1Cl.Cl |
| InChI | InChI=1S/2C27H43ClN8.ClH/c2*1-4-35(5-2)24-16-15-21(18-23(24)28)31-27-33-25(29-19-22-14-11-17-36(22)6-3)32-26(34-27)30-20-12-9-7-8-10-13-20;/h2*15-16,18,20,22H,4-14,17,19H2,1-3H3,(H3,29,30,31,32,33,34);1H |
| InChIKey | RCWIGLGGHQZELD-UHFFFAOYSA-N |
| XLogP | 12.71 |
| TPSA | 162.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 73 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1066.76 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|