C27H43IN8 — CID 71126194
2-N-cycloheptyl-4-N-[4-(diethylamino)-3-iodophenyl]-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 71126194) has the molecular formula C27H43IN8 and a molecular weight of 606.60 g/mol. Its IUPAC name is 2-N-cycloheptyl-4-N-[4-(diethylamino)-3-iodophenyl]-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-cycloheptyl-4-N-[4-(diethylamino)-3-iodophenyl]-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 71126194 |
| Molecular Formula | C27H43IN8 |
| Molecular Weight | 606.60 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | 2-N-cycloheptyl-4-N-[4-(diethylamino)-3-iodophenyl]-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1ccc(Nc2nc(NCC3CCCN3CC)nc(NC3CCCCCC3)n2)cc1I |
| InChI | InChI=1S/C27H43IN8/c1-4-35(5-2)24-16-15-21(18-23(24)28)31-27-33-25(29-19-22-14-11-17-36(22)6-3)32-26(34-27)30-20-12-9-7-8-10-13-20/h15-16,18,20,22H,4-14,17,19H2,1-3H3,(H3,29,30,31,32,33,34) |
| InChIKey | GKVKFVRIRNILQF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.60 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|