C23H35IN8 — CID 89297467
4-N-(4-amino-3-iodophenyl)-2-N-cycloheptyl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 89297467) has the molecular formula C23H35IN8 and a molecular weight of 550.49 g/mol. Its IUPAC name is 4-N-(4-amino-3-iodophenyl)-2-N-cycloheptyl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(4-amino-3-iodophenyl)-2-N-cycloheptyl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 89297467 |
| Molecular Formula | C23H35IN8 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 4-N-(4-amino-3-iodophenyl)-2-N-cycloheptyl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN1CCCC1CNc1nc(Nc2ccc(N)c(I)c2)nc(NC2CCCCCC2)n1 |
| InChI | InChI=1S/C23H35IN8/c1-2-32-13-7-10-18(32)15-26-21-29-22(27-16-8-5-3-4-6-9-16)31-23(30-21)28-17-11-12-20(25)19(24)14-17/h11-12,14,16,18H,2-10,13,15,25H2,1H3,(H3,26,27,28,29,30,31) |
| InChIKey | GBNDKBSKFMGIOL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|