C23H34BrN7O — CID 11466234
2-bromo-4-[[4-(cycloheptylamino)-6-[(1-ethylpyrrolidin-2-yl)methylamino]-1,3,5-triazin-2-yl]amino]phenol (PubChem CID 11466234) has the molecular formula C23H34BrN7O and a molecular weight of 504.48 g/mol. Its IUPAC name is 2-bromo-4-[[4-(cycloheptylamino)-6-[(1-ethylpyrrolidin-2-yl)methylamino]-1,3,5-triazin-2-yl]amino]phenol.
| Compound Name | 2-bromo-4-[[4-(cycloheptylamino)-6-[(1-ethylpyrrolidin-2-yl)methylamino]-1,3,5-triazin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 11466234 |
| Molecular Formula | C23H34BrN7O |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 2-bromo-4-[[4-(cycloheptylamino)-6-[(1-ethylpyrrolidin-2-yl)methylamino]-1,3,5-triazin-2-yl]amino]phenol |
| SMILES | CCN1CCCC1CNc1nc(Nc2ccc(O)c(Br)c2)nc(NC2CCCCCC2)n1 |
| InChI | InChI=1S/C23H34BrN7O/c1-2-31-13-7-10-18(31)15-25-21-28-22(26-16-8-5-3-4-6-9-16)30-23(29-21)27-17-11-12-20(32)19(24)14-17/h11-12,14,16,18,32H,2-10,13,15H2,1H3,(H3,25,26,27,28,29,30) |
| InChIKey | SYTZDVLVFLUNJI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|