C25H37N7O2 — CID 69483992
2-N-cycloheptyl-4-N-(2,3-dihydro-1,4-benzodioxin-5-yl)-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 69483992) has the molecular formula C25H37N7O2 and a molecular weight of 467.62 g/mol. Its IUPAC name is 2-N-cycloheptyl-4-N-(2,3-dihydro-1,4-benzodioxin-5-yl)-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-cycloheptyl-4-N-(2,3-dihydro-1,4-benzodioxin-5-yl)-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 69483992 |
| Molecular Formula | C25H37N7O2 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | 2-N-cycloheptyl-4-N-(2,3-dihydro-1,4-benzodioxin-5-yl)-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN1CCCC1CNc1nc(Nc2cccc3c2OCCO3)nc(NC2CCCCCC2)n1 |
| InChI | InChI=1S/C25H37N7O2/c1-2-32-14-8-11-19(32)17-26-23-29-24(27-18-9-5-3-4-6-10-18)31-25(30-23)28-20-12-7-13-21-22(20)34-16-15-33-21/h7,12-13,18-19H,2-6,8-11,14-17H2,1H3,(H3,26,27,28,29,30,31) |
| InChIKey | WNLDOCNQMTYKSO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |