C27H22N4O4 — CID 136596036
3-[4-[[3-(3,4-dihydronaphthalen-2-yl)-2-hydroxyphenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid (PubChem CID 136596036) has the molecular formula C27H22N4O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is 3-[4-[[3-(3,4-dihydronaphthalen-2-yl)-2-hydroxyphenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid.
| Compound Name | 3-[4-[[3-(3,4-dihydronaphthalen-2-yl)-2-hydroxyphenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 136596036 |
| Molecular Formula | C27H22N4O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 3-[4-[[3-(3,4-dihydronaphthalen-2-yl)-2-hydroxyphenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid |
| SMILES | Cc1[nH]n(-c2cccc(C(=O)O)c2)c(=O)c1/N=N/c1cccc(C2=Cc3ccccc3CC2)c1O |
| InChI | InChI=1S/C27H22N4O4/c1-16-24(26(33)31(30-16)21-9-4-8-20(15-21)27(34)35)29-28-23-11-5-10-22(25(23)32)19-13-12-17-6-2-3-7-18(17)14-19/h2-11,14-15,30,32H,12-13H2,1H3,(H,34,35)/b29-28+ |
| InChIKey | PBLYNTZNRQUTJG-ZQHSETAFSA-N |
| XLogP | 5.78 |
| TPSA | 120.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|