C25H23N5O3 — CID 136597329
4-[[3-(5-acetyl-1H-pyrrol-3-yl)-2-hydroxyphenyl]diazenyl]-2-(2,3-dihydro-1H-inden-5-yl)-5-methyl-1H-pyrazol-3-one (PubChem CID 136597329) has the molecular formula C25H23N5O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is 4-[[3-(5-acetyl-1H-pyrrol-3-yl)-2-hydroxyphenyl]diazenyl]-2-(2,3-dihydro-1H-inden-5-yl)-5-methyl-1H-pyrazol-3-one.
| Compound Name | 4-[[3-(5-acetyl-1H-pyrrol-3-yl)-2-hydroxyphenyl]diazenyl]-2-(2,3-dihydro-1H-inden-5-yl)-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 136597329 |
| Molecular Formula | C25H23N5O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 4-[[3-(5-acetyl-1H-pyrrol-3-yl)-2-hydroxyphenyl]diazenyl]-2-(2,3-dihydro-1H-inden-5-yl)-5-methyl-1H-pyrazol-3-one |
| SMILES | CC(=O)c1cc(-c2cccc(/N=N/c3c(C)[nH]n(-c4ccc5c(c4)CCC5)c3=O)c2O)c[nH]1 |
| InChI | InChI=1S/C25H23N5O3/c1-14-23(25(33)30(29-14)19-10-9-16-5-3-6-17(16)11-19)28-27-21-8-4-7-20(24(21)32)18-12-22(15(2)31)26-13-18/h4,7-13,26,29,32H,3,5-6H2,1-2H3/b28-27+ |
| InChIKey | LAXXJDTXCQOCNF-BYYHNAKLSA-N |
| XLogP | 5.28 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|