C26H24ClN5O4 — CID 135452902
6-[3-[[2-(4-tert-butylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-5-chloro-2-hydroxyphenyl]pyridine-2-carboxylic acid (PubChem CID 135452902) has the molecular formula C26H24ClN5O4 and a molecular weight of 505.96 g/mol. Its IUPAC name is 6-[3-[[2-(4-tert-butylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-5-chloro-2-hydroxyphenyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[3-[[2-(4-tert-butylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-5-chloro-2-hydroxyphenyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 135452902 |
| Molecular Formula | C26H24ClN5O4 |
| Molecular Weight | 505.96 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 6-[3-[[2-(4-tert-butylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-5-chloro-2-hydroxyphenyl]pyridine-2-carboxylic acid |
| SMILES | Cc1[nH]n(-c2ccc(C(C)(C)C)cc2)c(=O)c1/N=N/c1cc(Cl)cc(-c2cccc(C(=O)O)n2)c1O |
| InChI | InChI=1S/C26H24ClN5O4/c1-14-22(24(34)32(31-14)17-10-8-15(9-11-17)26(2,3)4)30-29-21-13-16(27)12-18(23(21)33)19-6-5-7-20(28-19)25(35)36/h5-13,31,33H,1-4H3,(H,35,36)/b30-29+ |
| InChIKey | YDSBSSGPLXJZQF-QVIHXGFCSA-N |
| XLogP | 6.31 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.96 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|