C26H21NO4 — CID 136601186
butyl 7-benzo[g][1,3]benzoxazol-2-yl-6-hydroxynaphthalene-2-carboxylate (PubChem CID 136601186) has the molecular formula C26H21NO4 and a molecular weight of 411.46 g/mol. Its IUPAC name is butyl 7-benzo[g][1,3]benzoxazol-2-yl-6-hydroxynaphthalene-2-carboxylate.
| Compound Name | butyl 7-benzo[g][1,3]benzoxazol-2-yl-6-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 136601186 |
| Molecular Formula | C26H21NO4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | butyl 7-benzo[g][1,3]benzoxazol-2-yl-6-hydroxynaphthalene-2-carboxylate |
| SMILES | CCCCOC(=O)c1ccc2cc(O)c(-c3nc4ccc5ccccc5c4o3)cc2c1 |
| InChI | InChI=1S/C26H21NO4/c1-2-3-12-30-26(29)18-9-8-17-15-23(28)21(14-19(17)13-18)25-27-22-11-10-16-6-4-5-7-20(16)24(22)31-25/h4-11,13-15,28H,2-3,12H2,1H3 |
| InChIKey | FFCKXIIBPVDZEH-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|