C19H22N4O3 — CID 136608734
1-(3,5-dimethoxyphenyl)-5-imino-4-(4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)-2H-pyrrol-3-ol (PubChem CID 136608734) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-5-imino-4-(4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)-2H-pyrrol-3-ol.
| Compound Name | 1-(3,5-dimethoxyphenyl)-5-imino-4-(4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136608734 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-5-imino-4-(4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3c([nH]2)CCCC3)=C(O)CN1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C19H22N4O3/c1-25-12-7-11(8-13(9-12)26-2)23-10-16(24)17(18(23)20)19-21-14-5-3-4-6-15(14)22-19/h7-9,20,24H,3-6,10H2,1-2H3,(H,21,22)/b20-18- |
| InChIKey | UCDXLSZNOMJDFY-ZZEZOPTASA-N |
| XLogP | 3.07 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|