C17H15N3O4S — CID 137128407
1-(3,5-dimethoxyphenyl)-5-imino-4-thieno[3,4-d][1,3]oxazol-2-yl-2H-pyrrol-3-ol (PubChem CID 137128407) has the molecular formula C17H15N3O4S and a molecular weight of 357.39 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-5-imino-4-thieno[3,4-d][1,3]oxazol-2-yl-2H-pyrrol-3-ol.
| Compound Name | 1-(3,5-dimethoxyphenyl)-5-imino-4-thieno[3,4-d][1,3]oxazol-2-yl-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 137128407 |
| Molecular Formula | C17H15N3O4S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-5-imino-4-thieno[3,4-d][1,3]oxazol-2-yl-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3cscc3o2)=C(O)CN1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C17H15N3O4S/c1-22-10-3-9(4-11(5-10)23-2)20-6-13(21)15(16(20)18)17-19-12-7-25-8-14(12)24-17/h3-5,7-8,18,21H,6H2,1-2H3/b18-16- |
| InChIKey | ZISJGPBKCYKQEK-VLGSPTGOSA-N |
| XLogP | 3.67 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|