C30H32Cl2N2O — CID 136609130
2-[4,5-bis(2-chlorophenyl)-1-methylimidazol-2-yl]-4,6-ditert-butylphenol (PubChem CID 136609130) has the molecular formula C30H32Cl2N2O and a molecular weight of 507.51 g/mol. Its IUPAC name is 2-[4,5-bis(2-chlorophenyl)-1-methylimidazol-2-yl]-4,6-ditert-butylphenol.
| Compound Name | 2-[4,5-bis(2-chlorophenyl)-1-methylimidazol-2-yl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 136609130 |
| Molecular Formula | C30H32Cl2N2O |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 2-[4,5-bis(2-chlorophenyl)-1-methylimidazol-2-yl]-4,6-ditert-butylphenol |
| SMILES | Cn1c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)nc(-c2ccccc2Cl)c1-c1ccccc1Cl |
| InChI | InChI=1S/C30H32Cl2N2O/c1-29(2,3)18-16-21(27(35)22(17-18)30(4,5)6)28-33-25(19-12-8-10-14-23(19)31)26(34(28)7)20-13-9-11-15-24(20)32/h8-17,35H,1-7H3 |
| InChIKey | VFCCZOWBPGBEKR-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |