C22H27N5O4 — CID 136610138
3-[[2,5-dihydroxy-4-[1-(5-methylfuran-2-yl)propylideneamino]-1H-pyrrol-3-yl]amino]-2-hydroxy-N,N,N'-trimethylbenzenecarboximidamide (PubChem CID 136610138) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is 3-[[2,5-dihydroxy-4-[1-(5-methylfuran-2-yl)propylideneamino]-1H-pyrrol-3-yl]amino]-2-hydroxy-N,N,N'-trimethylbenzenecarboximidamide.
| Compound Name | 3-[[2,5-dihydroxy-4-[1-(5-methylfuran-2-yl)propylideneamino]-1H-pyrrol-3-yl]amino]-2-hydroxy-N,N,N'-trimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 136610138 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 3-[[2,5-dihydroxy-4-[1-(5-methylfuran-2-yl)propylideneamino]-1H-pyrrol-3-yl]amino]-2-hydroxy-N,N,N'-trimethylbenzenecarboximidamide |
| SMILES | CC/C(=N\c1c(O)[nH]c(O)c1Nc1cccc(/C(=N/C)N(C)C)c1O)c1ccc(C)o1 |
| InChI | InChI=1S/C22H27N5O4/c1-6-14(16-11-10-12(2)31-16)24-17-18(22(30)26-21(17)29)25-15-9-7-8-13(19(15)28)20(23-3)27(4)5/h7-11,25-26,28-30H,6H2,1-5H3/b23-20-,24-14+ |
| InChIKey | SOBQSBVVAPSWPD-WYCMZUGJSA-N |
| XLogP | 4.25 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|