C28H31N5O4 — CID 136611299
3-[[2,5-dihydroxy-4-[1-(5-methylfuran-2-yl)propylideneamino]-1-phenylpyrrol-3-yl]amino]-2-hydroxy-N,N,N'-trimethylbenzenecarboximidamide (PubChem CID 136611299) has the molecular formula C28H31N5O4 and a molecular weight of 501.59 g/mol. Its IUPAC name is 3-[[2,5-dihydroxy-4-[1-(5-methylfuran-2-yl)propylideneamino]-1-phenylpyrrol-3-yl]amino]-2-hydroxy-N,N,N'-trimethylbenzenecarboximidamide.
| Compound Name | 3-[[2,5-dihydroxy-4-[1-(5-methylfuran-2-yl)propylideneamino]-1-phenylpyrrol-3-yl]amino]-2-hydroxy-N,N,N'-trimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 136611299 |
| Molecular Formula | C28H31N5O4 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 3-[[2,5-dihydroxy-4-[1-(5-methylfuran-2-yl)propylideneamino]-1-phenylpyrrol-3-yl]amino]-2-hydroxy-N,N,N'-trimethylbenzenecarboximidamide |
| SMILES | CC/C(=N\c1c(Nc2cccc(/C(=N/C)N(C)C)c2O)c(O)n(-c2ccccc2)c1O)c1ccc(C)o1 |
| InChI | InChI=1S/C28H31N5O4/c1-6-20(22-16-15-17(2)37-22)30-23-24(28(36)33(27(23)35)18-11-8-7-9-12-18)31-21-14-10-13-19(25(21)34)26(29-3)32(4)5/h7-16,31,34-36H,6H2,1-5H3/b29-26-,30-20+ |
| InChIKey | NLHXOYUROTZTDR-CAMCRYOKSA-N |
| XLogP | 5.71 |
| TPSA | 118.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|