C19H22N10O6 — CID 136610287
4,4-diamino-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-aminooxy-5-oxopentanoic acid (PubChem CID 136610287) has the molecular formula C19H22N10O6 and a molecular weight of 486.45 g/mol. Its IUPAC name is 4,4-diamino-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-aminooxy-5-oxopentanoic acid.
| Compound Name | 4,4-diamino-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-aminooxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 136610287 |
| Molecular Formula | C19H22N10O6 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 4,4-diamino-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-aminooxy-5-oxopentanoic acid |
| SMILES | NOC(=O)C(N)(N)CC(NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C19H22N10O6/c20-18-28-13-12(15(31)29-18)26-10(7-25-13)6-24-9-3-1-8(2-4-9)14(30)27-11(16(32)33)5-19(21,22)17(34)35-23/h1-4,7,11,24H,5-6,21-23H2,(H,27,30)(H,32,33)(H3,20,25,28,29,31) |
| InChIKey | XUBYMMZIWXLEOQ-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 280.34 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|