C32H41ClN3O6- — CID 136619253
7-chloro-8-[(2,5-dimethylpyrrolidin-1-yl)methyl]-3,10-dihydroxy-1-imino-12,12a-dimethoxy-4a-methyl-11-oxo-4-propan-2-yl-4,5,5a,6-tetrahydrotetracene-2-carboxamide (PubChem CID 136619253) has the molecular formula C32H41ClN3O6- and a molecular weight of 599.15 g/mol. Its IUPAC name is 7-chloro-8-[(2,5-dimethylpyrrolidin-1-yl)methyl]-3,10-dihydroxy-1-imino-12,12a-dimethoxy-4a-methyl-11-oxo-4-propan-2-yl-4,5,5a,6-tetrahydrotetracene-2-carboxamide.
| Compound Name | 7-chloro-8-[(2,5-dimethylpyrrolidin-1-yl)methyl]-3,10-dihydroxy-1-imino-12,12a-dimethoxy-4a-methyl-11-oxo-4-propan-2-yl-4,5,5a,6-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 136619253 |
| Molecular Formula | C32H41ClN3O6- |
| Molecular Weight | 599.15 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | 7-chloro-8-[(2,5-dimethylpyrrolidin-1-yl)methyl]-3,10-dihydroxy-1-imino-12,12a-dimethoxy-4a-methyl-11-oxo-4-propan-2-yl-4,5,5a,6-tetrahydrotetracene-2-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)=C(O)C([C-](C)C)C2(C)CC3Cc4c(Cl)c(CN5C(C)CCC5C)cc(O)c4C(=O)C3=C(OC)C12OC |
| InChI | InChI=1S/C32H41ClN3O6/c1-14(2)24-27(39)23(30(35)40)28(34)32(42-7)29(41-6)21-17(12-31(24,32)5)10-19-22(26(21)38)20(37)11-18(25(19)33)13-36-15(3)8-9-16(36)4/h11,15-17,24,34,37,39H,8-10,12-13H2,1-7H3,(H2,35,40)/q-1/b34-28+ |
| InChIKey | HZTRIDAUFKLCOW-CDSHQWRTSA-N |
| XLogP | 5.03 |
| TPSA | 146.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.15 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|