C31H42N4O7 — CID 91601732
8-[[cyclobutylmethyl(methyl)amino]methyl]-4-(dimethylamino)-10-hydroxy-1-imino-7,12,12a-trimethoxy-3,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 91601732) has the molecular formula C31H42N4O7 and a molecular weight of 582.70 g/mol. Its IUPAC name is 8-[[cyclobutylmethyl(methyl)amino]methyl]-4-(dimethylamino)-10-hydroxy-1-imino-7,12,12a-trimethoxy-3,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 8-[[cyclobutylmethyl(methyl)amino]methyl]-4-(dimethylamino)-10-hydroxy-1-imino-7,12,12a-trimethoxy-3,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91601732 |
| Molecular Formula | C31H42N4O7 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | 8-[[cyclobutylmethyl(methyl)amino]methyl]-4-(dimethylamino)-10-hydroxy-1-imino-7,12,12a-trimethoxy-3,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)C(=O)C(N(C)C)C2CC3Cc4c(OC)c(CN(C)CC5CCC5)cc(O)c4C(=O)C3=C(OC)C12OC |
| InChI | InChI=1S/C31H42N4O7/c1-34(2)24-19-11-16-10-18-22(20(36)12-17(27(18)40-4)14-35(3)13-15-8-7-9-15)25(37)21(16)29(41-5)31(19,42-6)28(32)23(26(24)38)30(33)39/h12,15-16,19,23-24,32,36H,7-11,13-14H2,1-6H3,(H2,33,39)/b32-28+ |
| InChIKey | IGGMOQZBFNRVKV-VEWQFJOQSA-N |
| XLogP | 1.93 |
| TPSA | 155.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|