C34H40N4O6 — CID 91556291
10-[(cyclopentylamino)methyl]-14-cyclopropyloxy-4-(dimethylamino)-12,14a-dihydroxy-1-imino-3,13-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 91556291) has the molecular formula C34H40N4O6 and a molecular weight of 600.72 g/mol. Its IUPAC name is 10-[(cyclopentylamino)methyl]-14-cyclopropyloxy-4-(dimethylamino)-12,14a-dihydroxy-1-imino-3,13-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | 10-[(cyclopentylamino)methyl]-14-cyclopropyloxy-4-(dimethylamino)-12,14a-dihydroxy-1-imino-3,13-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 91556291 |
| Molecular Formula | C34H40N4O6 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | 10-[(cyclopentylamino)methyl]-14-cyclopropyloxy-4-(dimethylamino)-12,14a-dihydroxy-1-imino-3,13-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)C(=O)C(N(C)C)C2CC3Cc4cc5ccc(CNC6CCCC6)cc5c(O)c4C(=O)C3=C(OC3CC3)C12O |
| InChI | InChI=1S/C34H40N4O6/c1-38(2)27-23-14-19-13-18-12-17-8-7-16(15-37-20-5-3-4-6-20)11-22(17)28(39)24(18)29(40)25(19)32(44-21-9-10-21)34(23,43)31(35)26(30(27)41)33(36)42/h7-8,11-12,19-21,23,26-27,35,37,39,43H,3-6,9-10,13-15H2,1-2H3,(H2,36,42)/b35-31+ |
| InChIKey | HKESCQKEFRGHOT-JSLDZMDGSA-N |
| XLogP | 2.75 |
| TPSA | 166.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|