C30H39ClN4O6 — CID 91098649
7-chloro-4-(dimethylamino)-10-hydroxy-1-imino-12,12a-dimethoxy-8-[[methyl-(1-methylcyclobutyl)amino]methyl]-3,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 91098649) has the molecular formula C30H39ClN4O6 and a molecular weight of 587.12 g/mol. Its IUPAC name is 7-chloro-4-(dimethylamino)-10-hydroxy-1-imino-12,12a-dimethoxy-8-[[methyl-(1-methylcyclobutyl)amino]methyl]-3,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 7-chloro-4-(dimethylamino)-10-hydroxy-1-imino-12,12a-dimethoxy-8-[[methyl-(1-methylcyclobutyl)amino]methyl]-3,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91098649 |
| Molecular Formula | C30H39ClN4O6 |
| Molecular Weight | 587.12 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | 7-chloro-4-(dimethylamino)-10-hydroxy-1-imino-12,12a-dimethoxy-8-[[methyl-(1-methylcyclobutyl)amino]methyl]-3,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)C(=O)C(N(C)C)C2CC3Cc4c(Cl)c(CN(C)C5(C)CCC5)cc(O)c4C(=O)C3=C(OC)C12OC |
| InChI | InChI=1S/C30H39ClN4O6/c1-29(8-7-9-29)35(4)13-15-12-18(36)20-16(22(15)31)10-14-11-17-23(34(2)3)25(38)21(28(33)39)26(32)30(17,41-6)27(40-5)19(14)24(20)37/h12,14,17,21,23,32,36H,7-11,13H2,1-6H3,(H2,33,39)/b32-26+ |
| InChIKey | AUCFNPBQDGMJGQ-HMZBKAONSA-N |
| XLogP | 2.71 |
| TPSA | 146.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.12 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|