C31H44N4O6 — CID 91572914
4-(dimethylamino)-10-hydroxy-1-imino-12,12a-dimethoxy-7-methyl-8-[1-[methyl(2-methylpropyl)amino]ethyl]-3,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 91572914) has the molecular formula C31H44N4O6 and a molecular weight of 568.72 g/mol. Its IUPAC name is 4-(dimethylamino)-10-hydroxy-1-imino-12,12a-dimethoxy-7-methyl-8-[1-[methyl(2-methylpropyl)amino]ethyl]-3,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-10-hydroxy-1-imino-12,12a-dimethoxy-7-methyl-8-[1-[methyl(2-methylpropyl)amino]ethyl]-3,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91572914 |
| Molecular Formula | C31H44N4O6 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | 4-(dimethylamino)-10-hydroxy-1-imino-12,12a-dimethoxy-7-methyl-8-[1-[methyl(2-methylpropyl)amino]ethyl]-3,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)C(=O)C(N(C)C)C2CC3Cc4c(C)c(C(C)N(C)CC(C)C)cc(O)c4C(=O)C3=C(OC)C12OC |
| InChI | InChI=1S/C31H44N4O6/c1-14(2)13-35(7)16(4)18-12-21(36)23-19(15(18)3)10-17-11-20-25(34(5)6)27(38)24(30(33)39)28(32)31(20,41-9)29(40-8)22(17)26(23)37/h12,14,16-17,20,24-25,32,36H,10-11,13H2,1-9H3,(H2,33,39)/b32-28+ |
| InChIKey | KLSVKQWBVOCOEU-VEWQFJOQSA-N |
| XLogP | 2.64 |
| TPSA | 146.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|