C30H37N5O6 — CID 90998496
4,7-bis(dimethylamino)-10-[(dimethylamino)methyl]-12,13,14a-trihydroxy-1-imino-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 90998496) has the molecular formula C30H37N5O6 and a molecular weight of 563.66 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-10-[(dimethylamino)methyl]-12,13,14a-trihydroxy-1-imino-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-10-[(dimethylamino)methyl]-12,13,14a-trihydroxy-1-imino-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 90998496 |
| Molecular Formula | C30H37N5O6 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | 4,7-bis(dimethylamino)-10-[(dimethylamino)methyl]-12,13,14a-trihydroxy-1-imino-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)C(=O)C(N(C)C)C2CC3Cc4c(c(O)c5cc(CN(C)C)ccc5c4N(C)C)C(O)=C3C(=O)C12O |
| InChI | InChI=1S/C30H37N5O6/c1-33(2)12-13-7-8-15-16(9-13)24(36)20-17(22(15)34(3)4)10-14-11-18-23(35(5)6)26(38)21(29(32)40)27(31)30(18,41)28(39)19(14)25(20)37/h7-9,14,18,21,23,31,36-37,41H,10-12H2,1-6H3,(H2,32,40)/b31-27+ |
| InChIKey | HTFTYEVKBOPMKF-TVKQRKNISA-N |
| XLogP | 1.07 |
| TPSA | 171.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|