C27H38N2O2 — CID 136630268
N-[(E)-(2-hydroxyphenyl)methylideneamino]-4-methyl-3,5-bis(2-methylpentan-2-yl)benzamide (PubChem CID 136630268) has the molecular formula C27H38N2O2 and a molecular weight of 422.61 g/mol. Its IUPAC name is N-[(E)-(2-hydroxyphenyl)methylideneamino]-4-methyl-3,5-bis(2-methylpentan-2-yl)benzamide.
| Compound Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-4-methyl-3,5-bis(2-methylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 136630268 |
| Molecular Formula | C27H38N2O2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-4-methyl-3,5-bis(2-methylpentan-2-yl)benzamide |
| SMILES | CCCC(C)(C)c1cc(C(=O)N/N=C/c2ccccc2O)cc(C(C)(C)CCC)c1C |
| InChI | InChI=1S/C27H38N2O2/c1-8-14-26(4,5)22-16-21(17-23(19(22)3)27(6,7)15-9-2)25(31)29-28-18-20-12-10-11-13-24(20)30/h10-13,16-18,30H,8-9,14-15H2,1-7H3,(H,29,31)/b28-18+ |
| InChIKey | VPZKZDFGJFBGDY-MTDXEUNCSA-N |
| XLogP | 6.62 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|