C12H9O6- — CID 136630884
2-[(2E,4Z)-5-carboxy-5-hydroxypenta-2,4-dienoyl]-6-hydroxyphenolate (PubChem CID 136630884) has the molecular formula C12H9O6- and a molecular weight of 249.20 g/mol. Its IUPAC name is 2-[(2E,4Z)-5-carboxy-5-hydroxypenta-2,4-dienoyl]-6-hydroxyphenolate.
| Compound Name | 2-[(2E,4Z)-5-carboxy-5-hydroxypenta-2,4-dienoyl]-6-hydroxyphenolate |
|---|---|
| PubChem CID | 136630884 |
| Molecular Formula | C12H9O6- |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 2-[(2E,4Z)-5-carboxy-5-hydroxypenta-2,4-dienoyl]-6-hydroxyphenolate |
| SMILES | O=C(O)/C(O)=C/C=C/C(=O)c1cccc(O)c1[O-] |
| InChI | InChI=1S/C12H10O6/c13-8(4-2-6-10(15)12(17)18)7-3-1-5-9(14)11(7)16/h1-6,14-16H,(H,17,18)/p-1/b4-2+,10-6- |
| InChIKey | JFQLMGJVLFOTFW-QXYPORFMSA-M |
| XLogP | 0.73 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|