C11H9ClN4O2 — CID 136643579
(6Z)-6-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-1,3-diazinane-2,4-dione (PubChem CID 136643579) has the molecular formula C11H9ClN4O2 and a molecular weight of 264.67 g/mol. Its IUPAC name is (6Z)-6-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-1,3-diazinane-2,4-dione.
| Compound Name | (6Z)-6-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 136643579 |
| Molecular Formula | C11H9ClN4O2 |
| Molecular Weight | 264.67 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | (6Z)-6-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-1,3-diazinane-2,4-dione |
| SMILES | O=C1C/C(=N/N=C/c2ccc(Cl)cc2)NC(=O)N1 |
| InChI | InChI=1S/C11H9ClN4O2/c12-8-3-1-7(2-4-8)6-13-16-9-5-10(17)15-11(18)14-9/h1-4,6H,5H2,(H2,14,15,16,17,18)/b13-6+ |
| InChIKey | BWJZGXMDIWSPON-AWNIVKPZSA-N |
| XLogP | 1.30 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.67 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|