C22H15ClN4O2 — CID 177409028
(5E)-5-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-1,3-diphenylimidazolidine-2,4-dione (PubChem CID 177409028) has the molecular formula C22H15ClN4O2 and a molecular weight of 402.84 g/mol. Its IUPAC name is (5E)-5-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-1,3-diphenylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-1,3-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 177409028 |
| Molecular Formula | C22H15ClN4O2 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (5E)-5-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-1,3-diphenylimidazolidine-2,4-dione |
| SMILES | O=C1/C(=N\N=C\c2ccc(Cl)cc2)N(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C22H15ClN4O2/c23-17-13-11-16(12-14-17)15-24-25-20-21(28)27(19-9-5-2-6-10-19)22(29)26(20)18-7-3-1-4-8-18/h1-15H/b24-15+,25-20+ |
| InChIKey | IQOWQJQKZCRCEA-CACOIOFQSA-N |
| XLogP | 4.75 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|