C20H18N4O2S2 — CID 136648805
5-[(1,3-diethyl-4-hydroxy-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylidene]-2-imino-4-phenylthiophene-3-carbonitrile (PubChem CID 136648805) has the molecular formula C20H18N4O2S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 5-[(1,3-diethyl-4-hydroxy-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylidene]-2-imino-4-phenylthiophene-3-carbonitrile.
| Compound Name | 5-[(1,3-diethyl-4-hydroxy-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylidene]-2-imino-4-phenylthiophene-3-carbonitrile |
|---|---|
| PubChem CID | 136648805 |
| Molecular Formula | C20H18N4O2S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 5-[(1,3-diethyl-4-hydroxy-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylidene]-2-imino-4-phenylthiophene-3-carbonitrile |
| SMILES | [H]/N=C1\SC(=Cc2c(O)n(CC)c(=S)n(CC)c2=O)C(c2ccccc2)=C1C#N |
| InChI | InChI=1S/C20H18N4O2S2/c1-3-23-18(25)13(19(26)24(4-2)20(23)27)10-15-16(12-8-6-5-7-9-12)14(11-21)17(22)28-15/h5-10,22,25H,3-4H2,1-2H3/b15-10?,22-17- |
| InChIKey | CZUMCBQTMUMFSN-YYWBYSFZSA-N |
| XLogP | 4.17 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|