C16H11Cl2N3O3 — CID 136650821
[2-[(3,4-dichlorophenyl)methyl]-4-oxo-3H-quinazolin-7-yl]carbamic acid (PubChem CID 136650821) has the molecular formula C16H11Cl2N3O3 and a molecular weight of 364.19 g/mol. Its IUPAC name is [2-[(3,4-dichlorophenyl)methyl]-4-oxo-3H-quinazolin-7-yl]carbamic acid.
| Compound Name | [2-[(3,4-dichlorophenyl)methyl]-4-oxo-3H-quinazolin-7-yl]carbamic acid |
|---|---|
| PubChem CID | 136650821 |
| Molecular Formula | C16H11Cl2N3O3 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | [2-[(3,4-dichlorophenyl)methyl]-4-oxo-3H-quinazolin-7-yl]carbamic acid |
| SMILES | O=C(O)Nc1ccc2c(=O)[nH]c(Cc3ccc(Cl)c(Cl)c3)nc2c1 |
| InChI | InChI=1S/C16H11Cl2N3O3/c17-11-4-1-8(5-12(11)18)6-14-20-13-7-9(19-16(23)24)2-3-10(13)15(22)21-14/h1-5,7,19H,6H2,(H,23,24)(H,20,21,22) |
| InChIKey | HDVHHGIXSPENBG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |