C12H10Br2N2O2S — CID 136656839
5-[(3,5-dibromo-2-methoxyphenyl)methylidene]-2-methylimino-1,3-thiazolidin-4-one (PubChem CID 136656839) has the molecular formula C12H10Br2N2O2S and a molecular weight of 406.10 g/mol. Its IUPAC name is 5-[(3,5-dibromo-2-methoxyphenyl)methylidene]-2-methylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3,5-dibromo-2-methoxyphenyl)methylidene]-2-methylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136656839 |
| Molecular Formula | C12H10Br2N2O2S |
| Molecular Weight | 406.10 g/mol |
| Exact Mass | 403.88 |
| IUPAC Name | 5-[(3,5-dibromo-2-methoxyphenyl)methylidene]-2-methylimino-1,3-thiazolidin-4-one |
| SMILES | C/N=C1\NC(=O)C(=Cc2cc(Br)cc(Br)c2OC)S1 |
| InChI | InChI=1S/C12H10Br2N2O2S/c1-15-12-16-11(17)9(19-12)4-6-3-7(13)5-8(14)10(6)18-2/h3-5H,1-2H3,(H,15,16,17) |
| InChIKey | SMEXDGPOJDSRMO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.10 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|