About 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]imidazolidine-2,4-dione
1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]imidazolidine-2,4-dione (PubChem CID 9350913) has the molecular formula C11H9Br2N3O3
and a molecular weight of 391.02 g/mol. Its IUPAC name is 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]imidazolidine-2,4-dione |
| PubChem CID | 9350913 |
| Molecular Formula | C11H9Br2N3O3 |
| Molecular Weight | 391.02 g/mol |
| Exact Mass | 388.90 |
| IUPAC Name | 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]imidazolidine-2,4-dione |
| SMILES | COc1c(Br)cc(Br)cc1/C=N\N1CC(=O)NC1=O |
| InChI | InChI=1S/C11H9Br2N3O3/c1-19-10-6(2-7(12)3-8(10)13)4-14-16-5-9(17)15-11(16)18/h2-4H,5H2,1H3,(H,15,17,18)/b14-4- |
| InChIKey | BZUFQVIWQJMCBZ-CPSFFCFKSA-N |
| XLogP | 2.11 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.02 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]imidazolidine-2,4-dione?
The IUPAC name of 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]imidazolidine-2,4-dione (CID 9350913) is 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]imidazolidine-2,4-dione.
What is the SMILES notation for 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]imidazolidine-2,4-dione?
The canonical SMILES for 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]imidazolidine-2,4-dione is COc1c(Br)cc(Br)cc1/C=N\N1CC(=O)NC1=O.
What is the InChIKey of 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]imidazolidine-2,4-dione?
The InChIKey is BZUFQVIWQJMCBZ-CPSFFCFKSA-N. The full InChI is InChI=1S/C11H9Br2N3O3/c1-19-10-6(2-7(12)3-8(10)13)4-14-16-5-9(17)15-11(16)18/h2-4H,5H2,1H3,(H,15,17,18)/b14-4-.
What are the key properties of 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]imidazolidine-2,4-dione?
1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]imidazolidine-2,4-dione has a molecular weight of 391.02 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]imidazolidine-2,4-dione is sourced from PubChem (CID 9350913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).