C11H15ClN4O — CID 136657255
3-tert-butyl-5-(2-chloroethyl)-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one (PubChem CID 136657255) has the molecular formula C11H15ClN4O and a molecular weight of 254.72 g/mol. Its IUPAC name is 3-tert-butyl-5-(2-chloroethyl)-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one.
| Compound Name | 3-tert-butyl-5-(2-chloroethyl)-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 136657255 |
| Molecular Formula | C11H15ClN4O |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 3-tert-butyl-5-(2-chloroethyl)-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one |
| SMILES | CC(C)(C)c1[nH]nc2c(=O)[nH]c(CCCl)nc12 |
| InChI | InChI=1S/C11H15ClN4O/c1-11(2,3)9-7-8(15-16-9)10(17)14-6(13-7)4-5-12/h4-5H2,1-3H3,(H,15,16)(H,13,14,17) |
| InChIKey | FRFGGANTIUHABV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|