C9H11NO4 — CID 136660682
5-(ethoxyiminomethyl)benzene-1,2,3-triol (PubChem CID 136660682) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 5-(ethoxyiminomethyl)benzene-1,2,3-triol.
| Compound Name | 5-(ethoxyiminomethyl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 136660682 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 5-(ethoxyiminomethyl)benzene-1,2,3-triol |
| SMILES | CCON=Cc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C9H11NO4/c1-2-14-10-5-6-3-7(11)9(13)8(12)4-6/h3-5,11-13H,2H2,1H3 |
| InChIKey | VIONNQOFAQOYLB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|