C12H12BrN5O2 — CID 136665953
2-bromo-N'-(6-ethyl-5-oxo-4H-1,2,4-triazin-3-yl)benzohydrazide (PubChem CID 136665953) has the molecular formula C12H12BrN5O2 and a molecular weight of 338.17 g/mol. Its IUPAC name is 2-bromo-N'-(6-ethyl-5-oxo-4H-1,2,4-triazin-3-yl)benzohydrazide.
| Compound Name | 2-bromo-N'-(6-ethyl-5-oxo-4H-1,2,4-triazin-3-yl)benzohydrazide |
|---|---|
| PubChem CID | 136665953 |
| Molecular Formula | C12H12BrN5O2 |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 2-bromo-N'-(6-ethyl-5-oxo-4H-1,2,4-triazin-3-yl)benzohydrazide |
| SMILES | CCc1nnc(NNC(=O)c2ccccc2Br)[nH]c1=O |
| InChI | InChI=1S/C12H12BrN5O2/c1-2-9-11(20)14-12(17-15-9)18-16-10(19)7-5-3-4-6-8(7)13/h3-6H,2H2,1H3,(H,16,19)(H2,14,17,18,20) |
| InChIKey | MQBYSTYTICQYAU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|