C17H17NO — CID 136671024
(4Z)-4-benzylidene-2-methyl-2-azaspiro[4.5]deca-6,9-dien-3-one (PubChem CID 136671024) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is (4Z)-4-benzylidene-2-methyl-2-azaspiro[4.5]deca-6,9-dien-3-one.
| Compound Name | (4Z)-4-benzylidene-2-methyl-2-azaspiro[4.5]deca-6,9-dien-3-one |
|---|---|
| PubChem CID | 136671024 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (4Z)-4-benzylidene-2-methyl-2-azaspiro[4.5]deca-6,9-dien-3-one |
| SMILES | CN1CC2(C=CCC=C2)/C(=C/c2ccccc2)C1=O |
| InChI | InChI=1S/C17H17NO/c1-18-13-17(10-6-3-7-11-17)15(16(18)19)12-14-8-4-2-5-9-14/h2,4-12H,3,13H2,1H3/b15-12+ |
| InChIKey | JVNOXCGCAXNJBF-NTCAYCPXSA-N |
| XLogP | 3.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|