C23H34BNO3 — CID 138984977
(3Z,4R)-3-benzylidene-1-tert-butyl-4-methyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pyrrolidin-2-one (PubChem CID 138984977) has the molecular formula C23H34BNO3 and a molecular weight of 383.34 g/mol. Its IUPAC name is (3Z,4R)-3-benzylidene-1-tert-butyl-4-methyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pyrrolidin-2-one.
| Compound Name | (3Z,4R)-3-benzylidene-1-tert-butyl-4-methyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 138984977 |
| Molecular Formula | C23H34BNO3 |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | (3Z,4R)-3-benzylidene-1-tert-butyl-4-methyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)N1C[C@](C)(CB2OC(C)(C)C(C)(C)O2)/C(=C/c2ccccc2)C1=O |
| InChI | InChI=1S/C23H34BNO3/c1-20(2,3)25-16-23(8,15-24-27-21(4,5)22(6,7)28-24)18(19(25)26)14-17-12-10-9-11-13-17/h9-14H,15-16H2,1-8H3/b18-14+/t23-/m0/s1 |
| InChIKey | QKOOCHLVDNNHBY-OTRAAIJSSA-N |
| XLogP | 4.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|