About CID 136675423
CID 136675423 (PubChem CID 136675423) has the molecular formula C14H32BP
and a molecular weight of 242.20 g/mol.
Molecular Properties
| Compound Name | CID 136675423 |
| PubChem CID | 136675423 |
| Molecular Formula | C14H32BP |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.23 |
| IUPAC Name | — |
| SMILES | CC[B-][P+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C14H32BP/c1-5-9-12-16(15-8-4,13-10-6-2)14-11-7-3/h5-14H2,1-4H3 |
| InChIKey | RVAIBSKPRVNEGY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 136675423 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136675423?
The IUPAC name of CID 136675423 (CID 136675423) is not available.
What is the SMILES notation for CID 136675423?
The canonical SMILES for CID 136675423 is CC[B-][P+](CCCC)(CCCC)CCCC.
What is the InChIKey of CID 136675423?
The InChIKey is RVAIBSKPRVNEGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32BP/c1-5-9-12-16(15-8-4,13-10-6-2)14-11-7-3/h5-14H2,1-4H3.
What are the key properties of CID 136675423?
CID 136675423 has a molecular weight of 242.20 g/mol, XLogP of 5.46, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136675423 is sourced from PubChem (CID 136675423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).