C28H24N6O3S — CID 136689124
4-methyl-N-[4-[[(4R)-5-oxo-1-phenyl-3-phenyliminopyrazolidin-4-yl]diazenyl]phenyl]benzenesulfonamide (PubChem CID 136689124) has the molecular formula C28H24N6O3S and a molecular weight of 524.61 g/mol. Its IUPAC name is 4-methyl-N-[4-[[(4R)-5-oxo-1-phenyl-3-phenyliminopyrazolidin-4-yl]diazenyl]phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[4-[[(4R)-5-oxo-1-phenyl-3-phenyliminopyrazolidin-4-yl]diazenyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 136689124 |
| Molecular Formula | C28H24N6O3S |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 4-methyl-N-[4-[[(4R)-5-oxo-1-phenyl-3-phenyliminopyrazolidin-4-yl]diazenyl]phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(/N=N/[C@H]3C(=O)N(c4ccccc4)N/C3=N\c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H24N6O3S/c1-20-12-18-25(19-13-20)38(36,37)33-23-16-14-22(15-17-23)30-31-26-27(29-21-8-4-2-5-9-21)32-34(28(26)35)24-10-6-3-7-11-24/h2-19,26,33H,1H3,(H,29,32)/b31-30+/t26-/m1/s1 |
| InChIKey | HLYZXQCGMHGDTA-YQIGTUNFSA-N |
| XLogP | 5.53 |
| TPSA | 115.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|