C24H15ClN8 — CID 136697158
7-amino-5-(4-chlorophenyl)-3-phenyldiazenyl-2-pyridin-4-ylpyrazolo[1,5-a]pyrimidine-6-carbonitrile (PubChem CID 136697158) has the molecular formula C24H15ClN8 and a molecular weight of 450.89 g/mol. Its IUPAC name is 7-amino-5-(4-chlorophenyl)-3-phenyldiazenyl-2-pyridin-4-ylpyrazolo[1,5-a]pyrimidine-6-carbonitrile.
| Compound Name | 7-amino-5-(4-chlorophenyl)-3-phenyldiazenyl-2-pyridin-4-ylpyrazolo[1,5-a]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 136697158 |
| Molecular Formula | C24H15ClN8 |
| Molecular Weight | 450.89 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 7-amino-5-(4-chlorophenyl)-3-phenyldiazenyl-2-pyridin-4-ylpyrazolo[1,5-a]pyrimidine-6-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2)nc2c(/N=N/c3ccccc3)c(-c3ccncc3)nn2c1N |
| InChI | InChI=1S/C24H15ClN8/c25-17-8-6-15(7-9-17)20-19(14-26)23(27)33-24(29-20)22(31-30-18-4-2-1-3-5-18)21(32-33)16-10-12-28-13-11-16/h1-13H,27H2/b31-30+ |
| InChIKey | ZCINAMBAESUNBU-NVQSTNCTSA-N |
| XLogP | 5.98 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.89 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|