C17H14F3N3S — CID 136697434
(6R)-5,6-diphenyl-N-(2,2,2-trifluoroethyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 136697434) has the molecular formula C17H14F3N3S and a molecular weight of 349.38 g/mol. Its IUPAC name is (6R)-5,6-diphenyl-N-(2,2,2-trifluoroethyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | (6R)-5,6-diphenyl-N-(2,2,2-trifluoroethyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 136697434 |
| Molecular Formula | C17H14F3N3S |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | (6R)-5,6-diphenyl-N-(2,2,2-trifluoroethyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | FC(F)(F)C/N=C1/NN=C(c2ccccc2)[C@@H](c2ccccc2)S1 |
| InChI | InChI=1S/C17H14F3N3S/c18-17(19,20)11-21-16-23-22-14(12-7-3-1-4-8-12)15(24-16)13-9-5-2-6-10-13/h1-10,15H,11H2,(H,21,23)/t15-/m1/s1 |
| InChIKey | RDNFICAJQOCLJD-OAHLLOKOSA-N |
| XLogP | 4.39 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|