C10H9F2N3O — CID 136710884
5-(3,5-difluorophenyl)-2-methyliminoimidazolidin-4-one (PubChem CID 136710884) has the molecular formula C10H9F2N3O and a molecular weight of 225.20 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)-2-methyliminoimidazolidin-4-one.
| Compound Name | 5-(3,5-difluorophenyl)-2-methyliminoimidazolidin-4-one |
|---|---|
| PubChem CID | 136710884 |
| Molecular Formula | C10H9F2N3O |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 5-(3,5-difluorophenyl)-2-methyliminoimidazolidin-4-one |
| SMILES | C/N=C1\NC(=O)C(c2cc(F)cc(F)c2)N1 |
| InChI | InChI=1S/C10H9F2N3O/c1-13-10-14-8(9(16)15-10)5-2-6(11)4-7(12)3-5/h2-4,8H,1H3,(H2,13,14,15,16) |
| InChIKey | GVBGLSHBJBFAJL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|