C22H24Br2N4O2 — CID 136717154
5,16-dibromo-1,9,12,20-tetrazatetracyclo[18.2.2.13,7.114,18]hexacosa-3(26),4,6,8,12,14,16,18(25)-octaene-25,26-diol (PubChem CID 136717154) has the molecular formula C22H24Br2N4O2 and a molecular weight of 536.27 g/mol. Its IUPAC name is 5,16-dibromo-1,9,12,20-tetrazatetracyclo[18.2.2.13,7.114,18]hexacosa-3(26),4,6,8,12,14,16,18(25)-octaene-25,26-diol.
| Compound Name | 5,16-dibromo-1,9,12,20-tetrazatetracyclo[18.2.2.13,7.114,18]hexacosa-3(26),4,6,8,12,14,16,18(25)-octaene-25,26-diol |
|---|---|
| PubChem CID | 136717154 |
| Molecular Formula | C22H24Br2N4O2 |
| Molecular Weight | 536.27 g/mol |
| Exact Mass | 534.03 |
| IUPAC Name | 5,16-dibromo-1,9,12,20-tetrazatetracyclo[18.2.2.13,7.114,18]hexacosa-3(26),4,6,8,12,14,16,18(25)-octaene-25,26-diol |
| SMILES | Oc1c2cc(Br)cc1CN1CCN(CC1)Cc1cc(Br)cc(c1O)/C=N/CC/N=C/2 |
| InChI | InChI=1S/C22H24Br2N4O2/c23-19-7-15-11-25-1-2-26-12-16-8-20(24)10-18(22(16)30)14-28-5-3-27(4-6-28)13-17(9-19)21(15)29/h7-12,29-30H,1-6,13-14H2/b25-11+,26-12+ |
| InChIKey | YAVLGHHKPXGBQC-KOZSXFMUSA-N |
| XLogP | 3.79 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|