C23H28Br2N4O2 — CID 136881961
10,22-dibromo-3,6-dimethyl-3,6,14,18-tetrazatricyclo[18.3.1.18,12]pentacosa-1(24),8(25),9,11,13,18,20,22-octaene-24,25-diol (PubChem CID 136881961) has the molecular formula C23H28Br2N4O2 and a molecular weight of 552.31 g/mol. Its IUPAC name is 10,22-dibromo-3,6-dimethyl-3,6,14,18-tetrazatricyclo[18.3.1.18,12]pentacosa-1(24),8(25),9,11,13,18,20,22-octaene-24,25-diol.
| Compound Name | 10,22-dibromo-3,6-dimethyl-3,6,14,18-tetrazatricyclo[18.3.1.18,12]pentacosa-1(24),8(25),9,11,13,18,20,22-octaene-24,25-diol |
|---|---|
| PubChem CID | 136881961 |
| Molecular Formula | C23H28Br2N4O2 |
| Molecular Weight | 552.31 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | 10,22-dibromo-3,6-dimethyl-3,6,14,18-tetrazatricyclo[18.3.1.18,12]pentacosa-1(24),8(25),9,11,13,18,20,22-octaene-24,25-diol |
| SMILES | CN1CCN(C)Cc2cc(Br)cc(c2O)/C=N/CCC/N=C/c2cc(Br)cc(c2O)C1 |
| InChI | InChI=1S/C23H28Br2N4O2/c1-28-6-7-29(2)15-19-11-21(25)9-17(23(19)31)13-27-5-3-4-26-12-16-8-20(24)10-18(14-28)22(16)30/h8-13,30-31H,3-7,14-15H2,1-2H3/b26-12+,27-13+ |
| InChIKey | MYLPJQYKDWRBBB-JCAXBWHZSA-N |
| XLogP | 4.43 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|