C33H40N2O2 — CID 136726829
2,4-ditert-butyl-6-[[(1S,8S,9R)-5-(2-hydroxyphenyl)-10,10-dimethyl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-8-yl]iminomethyl]phenol (PubChem CID 136726829) has the molecular formula C33H40N2O2 and a molecular weight of 496.70 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[(1S,8S,9R)-5-(2-hydroxyphenyl)-10,10-dimethyl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-8-yl]iminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[(1S,8S,9R)-5-(2-hydroxyphenyl)-10,10-dimethyl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-8-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136726829 |
| Molecular Formula | C33H40N2O2 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | 2,4-ditert-butyl-6-[[(1S,8S,9R)-5-(2-hydroxyphenyl)-10,10-dimethyl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-8-yl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/[C@@H]2c3nc(-c4ccccc4O)ccc3[C@H]3C[C@@H]2C3(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H40N2O2/c1-31(2,3)20-15-19(30(37)25(16-20)32(4,5)6)18-34-29-24-17-23(33(24,7)8)21-13-14-26(35-28(21)29)22-11-9-10-12-27(22)36/h9-16,18,23-24,29,36-37H,17H2,1-8H3/b34-18+/t23-,24+,29+/m1/s1 |
| InChIKey | BTHNRCGMSZWAIP-HDLKDLKZSA-N |
| XLogP | 8.06 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|