C48H64N2O2 — CID 136738351
2-tert-butyl-4-[2-[4-[2-[3-tert-butyl-4-hydroxy-5-(octyliminomethyl)phenyl]ethynyl]phenyl]ethynyl]-6-(octyliminomethyl)phenol (PubChem CID 136738351) has the molecular formula C48H64N2O2 and a molecular weight of 701.05 g/mol. Its IUPAC name is 2-tert-butyl-4-[2-[4-[2-[3-tert-butyl-4-hydroxy-5-(octyliminomethyl)phenyl]ethynyl]phenyl]ethynyl]-6-(octyliminomethyl)phenol.
| Compound Name | 2-tert-butyl-4-[2-[4-[2-[3-tert-butyl-4-hydroxy-5-(octyliminomethyl)phenyl]ethynyl]phenyl]ethynyl]-6-(octyliminomethyl)phenol |
|---|---|
| PubChem CID | 136738351 |
| Molecular Formula | C48H64N2O2 |
| Molecular Weight | 701.05 g/mol |
| Exact Mass | 700.50 |
| IUPAC Name | 2-tert-butyl-4-[2-[4-[2-[3-tert-butyl-4-hydroxy-5-(octyliminomethyl)phenyl]ethynyl]phenyl]ethynyl]-6-(octyliminomethyl)phenol |
| SMILES | CCCCCCCC/N=C/c1cc(C#Cc2ccc(C#Cc3cc(/C=N/CCCCCCCC)c(O)c(C(C)(C)C)c3)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C48H64N2O2/c1-9-11-13-15-17-19-29-49-35-41-31-39(33-43(45(41)51)47(3,4)5)27-25-37-21-23-38(24-22-37)26-28-40-32-42(46(52)44(34-40)48(6,7)8)36-50-30-20-18-16-14-12-10-2/h21-24,31-36,51-52H,9-20,29-30H2,1-8H3/b49-35+,50-36+ |
| InChIKey | BVLMASATIRICBE-YVXAEKBZSA-N |
| XLogP | 12.05 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.05 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|