C28H25N5O2 — CID 136744464
(6S,8R)-8-hydroxy-6-methyl-3-trityl-5,6,7,8-tetrahydropyrimido[1,2-a]purin-10-one (PubChem CID 136744464) has the molecular formula C28H25N5O2 and a molecular weight of 463.54 g/mol. Its IUPAC name is (6S,8R)-8-hydroxy-6-methyl-3-trityl-5,6,7,8-tetrahydropyrimido[1,2-a]purin-10-one.
| Compound Name | (6S,8R)-8-hydroxy-6-methyl-3-trityl-5,6,7,8-tetrahydropyrimido[1,2-a]purin-10-one |
|---|---|
| PubChem CID | 136744464 |
| Molecular Formula | C28H25N5O2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | (6S,8R)-8-hydroxy-6-methyl-3-trityl-5,6,7,8-tetrahydropyrimido[1,2-a]purin-10-one |
| SMILES | C[C@H]1C[C@@H](O)n2c(nc3c(ncn3C(c3ccccc3)(c3ccccc3)c3ccccc3)c2=O)N1 |
| InChI | InChI=1S/C28H25N5O2/c1-19-17-23(34)33-26(35)24-25(31-27(33)30-19)32(18-29-24)28(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,18-19,23,34H,17H2,1H3,(H,30,31)/t19-,23+/m0/s1 |
| InChIKey | SNGCXWAFWUKDGW-WMZHIEFXSA-N |
| XLogP | 4.13 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|