C11H11N5O5 — CID 71434572
3,5-diacetyl-6,7-dihydroxy-6,7-dihydroimidazo[1,2-a]purin-9-one (PubChem CID 71434572) has the molecular formula C11H11N5O5 and a molecular weight of 293.24 g/mol. Its IUPAC name is 3,5-diacetyl-6,7-dihydroxy-6,7-dihydroimidazo[1,2-a]purin-9-one.
| Compound Name | 3,5-diacetyl-6,7-dihydroxy-6,7-dihydroimidazo[1,2-a]purin-9-one |
|---|---|
| PubChem CID | 71434572 |
| Molecular Formula | C11H11N5O5 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3,5-diacetyl-6,7-dihydroxy-6,7-dihydroimidazo[1,2-a]purin-9-one |
| SMILES | CC(=O)N1c2nc3c(ncn3C(C)=O)c(=O)n2C(O)C1O |
| InChI | InChI=1S/C11H11N5O5/c1-4(17)14-3-12-6-7(14)13-11-15(5(2)18)9(20)10(21)16(11)8(6)19/h3,9-10,20-21H,1-2H3 |
| InChIKey | GOKIGDBPZZUKQF-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |