C27H23N5O5 — CID 136744983
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (3R)-3-(carbamoylamino)-3-(3-phenoxyphenyl)propanoate (PubChem CID 136744983) has the molecular formula C27H23N5O5 and a molecular weight of 497.51 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (3R)-3-(carbamoylamino)-3-(3-phenoxyphenyl)propanoate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (3R)-3-(carbamoylamino)-3-(3-phenoxyphenyl)propanoate |
|---|---|
| PubChem CID | 136744983 |
| Molecular Formula | C27H23N5O5 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (3R)-3-(carbamoylamino)-3-(3-phenoxyphenyl)propanoate |
| SMILES | N#CC(=C(O)COC(=O)C[C@@H](NC(N)=O)c1cccc(Oc2ccccc2)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C27H23N5O5/c28-15-20(26-30-21-11-4-5-12-22(21)31-26)24(33)16-36-25(34)14-23(32-27(29)35)17-7-6-10-19(13-17)37-18-8-2-1-3-9-18/h1-13,23,33H,14,16H2,(H,30,31)(H3,29,32,35)/t23-/m1/s1 |
| InChIKey | JJYHLOSZPWLPPD-HSZRJFAPSA-N |
| XLogP | 4.49 |
| TPSA | 163.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|